Lewis structures and skeletal structures
A quick way to draw the structure of a molecule is to look up the SMILES description of the molecule on pubchem or another cheminformatics site. To give an example, the SMILES of caffeine is CN1C=NC2=C1C(=O)N(C(=O)N2C)C.
Then, you can load this into a chemistry drawing program such as Chemdraw (commercial) or MarvinJS (online demo) or PubChem Sketcher. If necessary, you can change the orientation, make small change (e.g. change $\ce{#CH}$ to $\ce{#C-H}$) and add other molecules. Then, you can output an image, either a Lewis structure (with or without "lone pairs") or a skeletal structure. Here are the MarvinJS images (choosing 400 by 400 pixel size):
![enter image description here](https://cdn.statically.io/img/i.sstatic.net/2ib0V.png)
![enter image description here](https://cdn.statically.io/img/i.sstatic.net/yvfLr.png)
For a crude way of sizing the image, you can append a "b" or "s" to the image name after it is loaded, making it smaller.
![enter image description here](https://cdn.statically.io/img/i.sstatic.net/0OADDb.png)
You can also get an entire reaction by using reaction SMILES such as
CC(=O)O.OCC>[H+]>CC(=O)OCC
rendering
![enter image description here](https://cdn.statically.io/img/i.sstatic.net/3022A.png)