Wikipedia:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Adenosine monophosphate: Difference between pages
Appearance
(Difference between pages)
Content deleted Content added
Saving copy of the {{chembox}} taken from revid 473311633 of page Adenosine_monophosphate for the Chem/Drugbox validation project (updated: ''). |
Adenosine diphosphate is shortened to ADP not AMP, Adenosine monophosphate is shortened to AMP |
||
Line 1: | Line 1: | ||
{{more footnotes|date=February 2013}} |
|||
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid [{{fullurl:Adenosine_monophosphate|oldid=473311633}} 473311633] of page [[Adenosine_monophosphate]] with values updated to verified values.}} |
|||
{{use dmy dates|date=April 2020}} |
|||
{{chembox |
{{chembox |
||
| Verifiedfields = changed |
|||
| verifiedrevid = 443657695 |
|||
| Watchedfields = changed |
|||
| ImageFile = AMP structure.svg |
|||
| verifiedrevid = 477242440 |
|||
| ImageFile = Adenosinmonophosphat protoniert.svg |
|||
| ImageSize = 200px |
| ImageSize = 200px |
||
| ImageName = Skeletal formula of AMP |
| ImageName = Skeletal formula of AMP |
||
Line 8: | Line 11: | ||
| ImageSize1 = 200px |
| ImageSize1 = 200px |
||
| ImageName1 = Ball-and-stick model of AMP |
| ImageName1 = Ball-and-stick model of AMP |
||
| IUPACName = |
| IUPACName = -Adenylic acid |
||
| SystematicName = [(2''R'',3''S'',4''R'',5''R'')-5-(6-Amino-9''H''-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|||
| OtherNames = |
|||
| OtherNames = Adenosine 5'-monophosphate |
|||
| Section1 = {{Chembox Identifiers |
|||
|Section1={{Chembox Identifiers |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| PubChem = 6083 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| ChemSpiderID = 5858 |
| ChemSpiderID = 5858 |
||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
Line 25: | Line 30: | ||
| StdInChIKey = UDMBCSSLTHHNCD-KQYNXXCUSA-N |
| StdInChIKey = UDMBCSSLTHHNCD-KQYNXXCUSA-N |
||
| CASNo = 61-19-8 |
| CASNo = 61-19-8 |
||
| |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| PubChem = |
|||
| IUPHAR_ligand = 2455 |
| IUPHAR_ligand = 2455 |
||
| |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB00131 |
| DrugBank = DB00131 |
||
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
||
Line 35: | Line 39: | ||
| KEGG = C00020 |
| KEGG = C00020 |
||
| SMILES = O=P(O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3O |
| SMILES = O=P(O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3O |
||
| |
| MeSHName = Adenosine+monophosphate |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| C=10 | H=14 | N=5 | O=7 | P=1 |
|||
| Formula = C<sub>10</sub>H<sub>14</sub>N<sub>5</sub>O<sub>7</sub>P |
|||
| |
| MolarMass = 347.22 g/mol |
||
| |
| Appearance = |
||
| |
| pKa = 0.9, 3.8, 6.1 |
||
| |
| Density = |
||
| MeltingPtC = 178 to 185 |
|||
| MeltingPt = |
|||
| |
| = |
||
}} |
}} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| = |
||
| |
| = |
||
| |
| = |
||
| Autoignition = |
|||
}} |
}} |
||
}} |
}} |
||
'''Adenosine monophosphate''' ('''AMP'''), also known as '''5'-adenylic acid''', is a [[nucleotide]]. AMP consists of a [[phosphate]] group, the sugar [[ribose]], and the [[nucleobase]] [[adenine]]. It is an [[ester]] of [[phosphoric acid]] and the [[nucleoside]] [[adenosine]].<ref>{{cite web |title=Adenosine monophosphate (Compound) |url=https://pubchem.ncbi.nlm.nih.gov/compound/Adenosine-monophosphate |website=PubChem |publisher=NCBI |access-date=30 April 2020}}</ref> As a [[substituent]] it takes the form of the prefix '''adenylyl-'''.<ref>{{cite journal |title=Nomenclature of Carbohydrates: (Recommendations 1996) |journal=Journal of Carbohydrate Chemistry |date=1997 |volume=16 |issue=8 |pages=1191–1280 |doi=10.1080/07328309708005748}}</ref> |
|||
AMP plays an important role in many cellular metabolic processes, being interconverted to [[adenosine triphosphate]] (ATP) and [[adenosine diphosphate]] (ADP), as well as [[Allosteric regulation|allosterically]] activating enzymes such as myophosphorylase-b. AMP is also a component in the synthesis of [[RNA]].<ref>{{cite journal | vauthors = Jauker M, Griesser H, Richert C | title = Spontaneous Formation of RNA Strands, Peptidyl RNA, and Cofactors | journal = Angewandte Chemie | volume = 54 | issue = 48 | pages = 14564–9 | date = November 2015 | pmid = 26435376 | pmc = 4678511 | doi = 10.1002/anie.201506593 }}</ref> AMP is present in all known forms of life.<ref>{{cite web |title=Adenosine monophosphate |url=https://hmdb.ca/metabolites/HMDB0000045 |website=The Human Metabolome Database |access-date=3 July 2020}}</ref> |
|||
==Production and degradation== |
|||
AMP does not have the high energy [[phosphoanhydride]] bond associated with ADP and ATP. AMP can be produced from [[Adenosine diphosphate|ADP]] by the [[Adenylate kinase|myokinase (adenylate kinase)]] reaction when the ATP reservoir in the cell is low:<ref>{{Cite journal |last1=Baker |first1=Julien S. |last2=McCormick |first2=Marie Clare |last3=Robergs |first3=Robert A. |date=2010 |title=Interaction among Skeletal Muscle Metabolic Energy Systems during Intense Exercise |journal=Journal of Nutrition and Metabolism |volume=2010 |pages=905612 |doi=10.1155/2010/905612 |issn=2090-0732 |pmc=3005844 |pmid=21188163 |doi-access=free }}</ref><ref>{{Citation |last=Valberg |first=Stephanie J. |title=Chapter 15 - Skeletal Muscle Function |date=2008-01-01 |url=https://www.sciencedirect.com/science/article/pii/B9780123704917000155 |work=Clinical Biochemistry of Domestic Animals (Sixth Edition) |pages=459–484 |editor-last=Kaneko |editor-first=J. Jerry |access-date=2023-10-10 |place=San Diego |publisher=Academic Press |isbn=978-0-12-370491-7 |editor2-last=Harvey |editor2-first=John W. |editor3-last=Bruss |editor3-first=Michael L.}}</ref> |
|||
: 2 ADP → ATP + AMP |
|||
Or AMP may be produced by the [[hydrolysis]] of one [[high energy phosphate]] bond of ADP: |
|||
: ADP + H<sub>2</sub>O → AMP + [[phosphate|P<sub>i</sub>]] |
|||
AMP can also be formed by hydrolysis of [[Adenosine triphosphate|ATP]] into AMP and [[pyrophosphate]]: |
|||
: ATP + H<sub>2</sub>O → AMP + [[pyrophosphate|PP<sub>i</sub>]] |
|||
When RNA is broken down by living systems, nucleoside monophosphates, including adenosine monophosphate, are formed. |
|||
AMP can be regenerated to ATP as follows: |
|||
: AMP + ATP → 2 ADP (adenylate kinase in the opposite direction) |
|||
: ADP + P<sub>i</sub> → ATP (this step is most often performed in aerobes by the [[ATP synthase]] during [[oxidative phosphorylation]]) |
|||
AMP can be converted into [[inosine monophosphate]] by the [[enzyme]] [[myoadenylate deaminase]], freeing an [[ammonia]] group. |
|||
In a [[Catabolism|catabolic]] pathway, the [[purine nucleotide cycle]], adenosine monophosphate can be converted to [[uric acid]], which is excreted from the body in mammals.<ref>{{cite journal | vauthors = Maiuolo J, Oppedisano F, Gratteri S, Muscoli C, Mollace V | title = Regulation of uric acid metabolism and excretion | journal = International Journal of Cardiology | volume = 213 | pages = 8–14 | date = June 2016 | pmid = 26316329 | doi = 10.1016/j.ijcard.2015.08.109 | doi-access = free }}</ref> |
|||
== Physiological role in regulation == |
|||
=== AMP-activated kinase regulation === |
|||
The eukaryotic cell enzyme [[AMP-activated protein kinase|5' adenosine monophosphate-activated protein kinase]], or AMPK, utilizes AMP for [[Homeostasis|homeostatic]] energy processes during times of high cellular energy expenditure, such as exercise.<ref>{{cite journal | vauthors = Richter EA, Ruderman NB | title = AMPK and the biochemistry of exercise: implications for human health and disease | journal = The Biochemical Journal | volume = 418 | issue = 2 | pages = 261–75 | date = March 2009 | pmid = 19196246 | pmc = 2779044 | doi = 10.1042/BJ20082055 }}</ref> Since ATP cleavage, and corresponding [[phosphorylation]] reactions, are utilized in various processes throughout the body as a source of energy, ATP production is necessary to further create energy for those mammalian cells. AMPK, as a cellular energy sensor, is activated by decreasing levels of ATP, which is naturally accompanied by increasing levels of ADP and AMP.<ref>{{cite journal | vauthors = Carling D, Mayer FV, Sanders MJ, Gamblin SJ | title = AMP-activated protein kinase: nature's energy sensor | language = En | journal = Nature Chemical Biology | volume = 7 | issue = 8 | pages = 512–8 | date = July 2011 | pmid = 21769098 | doi = 10.1038/nchembio.610 }}</ref> |
|||
Though phosphorylation appears to be the main [[Enzyme activator|activator]] for AMPK, some studies suggest that AMP is an [[Allosteric regulation|allosteric regulator]] as well as a [[Agonist|direct agonist]] for AMPK.<ref>{{cite journal | vauthors = Faubert B, Vincent EE, Poffenberger MC, Jones RG | title = The AMP-activated protein kinase (AMPK) and cancer: many faces of a metabolic regulator | journal = Cancer Letters | volume = 356 | issue = 2 Pt A | pages = 165–70 | date = January 2015 | pmid = 24486219 | doi = 10.1016/j.canlet.2014.01.018 }}</ref> Furthermore, other studies suggest that the high ratio of AMP:ATP levels in cells, rather than just AMP, activate AMPK.<ref name=Hardie2011/> For example, the AMP-activated kinases of ''[[Caenorhabditis elegans]]'' and ''[[Drosophila melanogaster]]'' were found to have been activated by AMP, while [[yeast]] and plant kinases were not allosterically activated by AMP.<ref name=Hardie2011>{{Cite journal|vauthors=Hardie DG|date=2011-09-15|title=AMP-activated protein kinase—an energy sensor that regulates all aspects of cell function|journal=Genes & Development|language=en|volume=25|issue=18|pages=1895–1908|doi=10.1101/gad.17420111|issn=0890-9369|pmid=21937710|pmc=3185962}}</ref> |
|||
AMP binds to the ''γ''-subunit of AMPK, leading to the activation of the kinase, and then eventually a [[Cascade reaction|cascade]] of other processes such as the activation of [[Catabolism|catabolic]] pathways and [[Enzyme inhibitor|inhibition]] of [[Anabolism|anabolic]] pathways to regenerate ATP. Catabolic mechanisms, which generate ATP through the release of energy from breaking down molecules, are activated by the AMPK enzyme while anabolic mechanisms, which utilize energy from ATP to form products, are inhibited.<ref>{{cite journal | vauthors = Hardie DG | title = Energy sensing by the AMP-activated protein kinase and its effects on muscle metabolism | journal = The Proceedings of the Nutrition Society | volume = 70 | issue = 1 | pages = 92–9 | date = February 2011 | pmid = 21067629 | doi = 10.1017/S0029665110003915 | doi-access = free }}</ref> Though the ''γ-''subunit can bind AMP/ADP/ATP, only the binding of AMP/ADP results in a conformational shift of the enzyme protein. This variance in AMP/ADP versus ATP binding leads to a shift in the [[dephosphorylation]] state for the enzyme.<ref>{{cite journal | vauthors = Krishan S, Richardson DR, Sahni S | title = Adenosine monophosphate-activated kinase and its key role in catabolism: structure, regulation, biological activity, and pharmacological activation | journal = Molecular Pharmacology | volume = 87 | issue = 3 | pages = 363–77 | date = March 2015 | pmid = 25422142 | doi = 10.1124/mol.114.095810 | doi-access = free }}</ref> The dephosphorylation of AMPK through various protein [[phosphatase]]s completely inactivates catalytic function. AMP/ADP protects AMPK from being inactivated by binding to the ''γ''-subunit and maintaining the dephosphorylation state.<ref>{{cite journal | vauthors = Xiao B, Sanders MJ, Underwood E, Heath R, Mayer FV, Carmena D, Jing C, Walker PA, Eccleston JF, Haire LF, Saiu P, Howell SA, Aasland R, Martin SR, Carling D, Gamblin SJ | title = Structure of mammalian AMPK and its regulation by ADP | journal = Nature | volume = 472 | issue = 7342 | pages = 230–3 | date = April 2011 | pmid = 21399626 | pmc = 3078618 | doi = 10.1038/nature09932 | bibcode = 2011Natur.472..230X }}</ref> |
|||
==cAMP== |
|||
{{Main|Cyclic AMP}} |
|||
AMP can also exist as a cyclic structure known as [[cyclic adenosine monophosphate|cyclic AMP]] (or cAMP). Within certain cells the enzyme [[adenylate cyclase]] makes cAMP from ATP, and typically this reaction is regulated by hormones such as [[adrenaline]] or [[glucagon]]. cAMP plays an important role in intracellular signaling.<ref>{{Cite book|title=Metabolic Control|volume=233|last1=Ravnskjaer|first1=Kim|last2=Madiraju|first2=Anila|last3=Montminy|first3=Marc | name-list-style = vanc |date=2015|publisher=Springer, Cham|isbn=9783319298047|series=Handbook of Experimental Pharmacology|pages=29–49|doi=10.1007/164_2015_32|pmid = 26721678}}</ref> In skeletal muscle, cyclic AMP, triggered by adrenaline, starts a cascade ([[cAMP-dependent pathway]]) for the conversion of myophosphorylase-b into the phosphorylated form of [[Myophosphorylase|myophoshorylase]]-a for glycogenolysis.<ref>{{Cite book |last=Coffee |first=Carole J. |title=Quick Look Medicine: Metabolism |publisher=Hayes Barton Press |year=1999 |isbn=1-59377-192-4}}</ref><ref>{{Cite web |date=2022-01-01 |title=15.3: Glycogenolyis and its Regulation by Glucagon and Epinephrine Signaling |url=https://bio.libretexts.org/Bookshelves/Biochemistry/Fundamentals_of_Biochemistry_(Jakubowski_and_Flatt)/02%3A_Unit_II-_Bioenergetics_and_Metabolism/15%3A_Glucose_Glycogen_and_Their_Metabolic_Regulation/15.03%3A_15.3_Glycogenolyis_and_its_Regulation_by_Glucagon_and_Epinephrine_Signaling |access-date=2023-10-10 |website=Biology LibreTexts |language=en}}</ref> |
|||
== See also == |
|||
{{Columns-list|colwidth=16em| |
|||
* [[DNA]] |
|||
* [[Oligonucleotide]] |
|||
* [[Phosphodiesterase]] |
|||
* [[Glutamate flavoring]] |
|||
* [[Kikunae Ikeda]] |
|||
* [[Umami]] |
|||
* [[Ajinomoto]] |
|||
* [[Tien Chu Ve-Tsin]] |
|||
* [[Glutamic acid]] |
|||
* [[Disodium glutamate]] |
|||
* [[Monopotassium glutamate]] |
|||
* [[Disodium inosinate]] |
|||
* [[Guanosine monophosphate]] |
|||
* [[Inosinic acid]] |
|||
}} |
|||
== References == |
|||
{{Reflist|32em}} |
|||
== Further reading == |
|||
{{refbegin}} |
|||
* {{cite journal|vauthors= Ming D, Ninomiya Y, Margolskee RF|title= Blocking taste receptor activation of gustducin inhibits gustatory responses to bitter compounds|journal= Proceedings of the National Academy of Sciences of the United States of America|volume= 96|issue= 17|pages= 9903–8|date= August 1999|pmid= 10449792|pmc= 22308 |doi= 10.1073/pnas.96.17.9903|bibcode= 1999PNAS...96.9903M|doi-access= free}} |
|||
{{refend}} |
|||
== External links == |
|||
* [http://gmd.mpimp-golm.mpg.de/Spectrums/661B03AA-D8B1-4A01-9CEA-6BCEF0E7B15C.aspx GMD MS Spectrum] |
|||
{{Nucleobases, nucleosides, and nucleotides}} |
|||
{{Neurotransmitters}} |
|||
{{Purinergics}} |
|||
{{Authority control}} |
|||
{{DEFAULTSORT:Adenosine phosphate1}} |
|||
[[Category:Adenosine receptor agonists]] |
|||
[[Category:Neurotransmitters]] |
|||
[[Category:Nucleotides]] |
|||
[[Category:Phosphate esters]] |
|||
[[Category:Purines]] |